C23H23F2N3O — CID 95801530
(R)-[3-fluoro-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-pyridin-3-ylmethanol (PubChem CID 95801530) has the molecular formula C23H23F2N3O and a molecular weight of 395.45 g/mol. Its IUPAC name is (R)-[3-fluoro-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-pyridin-3-ylmethanol.
| Compound Name | (R)-[3-fluoro-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 95801530 |
| Molecular Formula | C23H23F2N3O |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (R)-[3-fluoro-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-pyridin-3-ylmethanol |
| SMILES | O[C@H](c1cccnc1)c1cccc(F)c1N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C23H23F2N3O/c24-20-8-2-1-5-18(20)16-27-11-13-28(14-12-27)22-19(7-3-9-21(22)25)23(29)17-6-4-10-26-15-17/h1-10,15,23,29H,11-14,16H2/t23-/m1/s1 |
| InChIKey | MYBPKDFURXOIRK-HSZRJFAPSA-N |
| XLogP | 3.76 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |