C16H16N2O5 — CID 95802344
7-(2-methoxyethyl)-4,14,16-trioxa-2,7-diazatetracyclo[9.7.0.03,9.013,17]octadeca-1,3(9),10,12,17-pentaen-6-one (PubChem CID 95802344) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-4,14,16-trioxa-2,7-diazatetracyclo[9.7.0.03,9.013,17]octadeca-1,3(9),10,12,17-pentaen-6-one.
| Compound Name | 7-(2-methoxyethyl)-4,14,16-trioxa-2,7-diazatetracyclo[9.7.0.03,9.013,17]octadeca-1,3(9),10,12,17-pentaen-6-one |
|---|---|
| PubChem CID | 95802344 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 7-(2-methoxyethyl)-4,14,16-trioxa-2,7-diazatetracyclo[9.7.0.03,9.013,17]octadeca-1,3(9),10,12,17-pentaen-6-one |
| SMILES | COCCN1Cc2cc3cc4c(cc3nc2OCC1=O)OCO4 |
| InChI | InChI=1S/C16H16N2O5/c1-20-3-2-18-7-11-4-10-5-13-14(23-9-22-13)6-12(10)17-16(11)21-8-15(18)19/h4-6H,2-3,7-9H2,1H3 |
| InChIKey | PWJYAPGGRDXRAB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |