C25H25N3O4 — CID 95802429
(4R)-8-[3-(1,3-dioxoisoindol-2-yl)propyl]-4-phenyl-2,8-diazaspiro[4.5]decane-1,3-dione (PubChem CID 95802429) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (4R)-8-[3-(1,3-dioxoisoindol-2-yl)propyl]-4-phenyl-2,8-diazaspiro[4.5]decane-1,3-dione.
| Compound Name | (4R)-8-[3-(1,3-dioxoisoindol-2-yl)propyl]-4-phenyl-2,8-diazaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 95802429 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (4R)-8-[3-(1,3-dioxoisoindol-2-yl)propyl]-4-phenyl-2,8-diazaspiro[4.5]decane-1,3-dione |
| SMILES | O=C1NC(=O)C2(CCN(CCCN3C(=O)c4ccccc4C3=O)CC2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H25N3O4/c29-21-20(17-7-2-1-3-8-17)25(24(32)26-21)11-15-27(16-12-25)13-6-14-28-22(30)18-9-4-5-10-19(18)23(28)31/h1-5,7-10,20H,6,11-16H2,(H,26,29,32)/t20-/m0/s1 |
| InChIKey | GZDQIEMIVXFUEN-FQEVSTJZSA-N |
| XLogP | 2.20 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|