C22H26N4O3S — CID 95803145
[(6aR,10aR)-10a-methyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazolin-7-yl]-(1-methylsulfonyl-2,3-dihydroindol-5-yl)methanone (PubChem CID 95803145) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is [(6aR,10aR)-10a-methyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazolin-7-yl]-(1-methylsulfonyl-2,3-dihydroindol-5-yl)methanone.
| Compound Name | [(6aR,10aR)-10a-methyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazolin-7-yl]-(1-methylsulfonyl-2,3-dihydroindol-5-yl)methanone |
|---|---|
| PubChem CID | 95803145 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(6aR,10aR)-10a-methyl-5,6,6a,8,9,10-hexahydropyrido[2,3-h]quinazolin-7-yl]-(1-methylsulfonyl-2,3-dihydroindol-5-yl)methanone |
| SMILES | C[C@@]12CCCN(C(=O)c3ccc4c(c3)CCN4S(C)(=O)=O)[C@@H]1CCc1cncnc12 |
| InChI | InChI=1S/C22H26N4O3S/c1-22-9-3-10-25(19(22)7-5-17-13-23-14-24-20(17)22)21(27)16-4-6-18-15(12-16)8-11-26(18)30(2,28)29/h4,6,12-14,19H,3,5,7-11H2,1-2H3/t19-,22-/m1/s1 |
| InChIKey | BTTCHPQUJBRWBP-DENIHFKCSA-N |
| XLogP | 2.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |