C19H21N3O — CID 95803942
(3aR,6aS)-3-(4-methylphenyl)-5-[(3-methyl-4-pyridinyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole (PubChem CID 95803942) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (3aR,6aS)-3-(4-methylphenyl)-5-[(3-methyl-4-pyridinyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole.
| Compound Name | (3aR,6aS)-3-(4-methylphenyl)-5-[(3-methyl-4-pyridinyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole |
|---|---|
| PubChem CID | 95803942 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (3aR,6aS)-3-(4-methylphenyl)-5-[(3-methyl-4-pyridinyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole |
| SMILES | Cc1ccc(C2=NO[C@@H]3CN(Cc4ccncc4C)C[C@H]23)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-13-3-5-15(6-4-13)19-17-11-22(12-18(17)23-21-19)10-16-7-8-20-9-14(16)2/h3-9,17-18H,10-12H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | VKNIUXSAIYILOP-ZWKOTPCHSA-N |
| XLogP | 2.93 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |