C10H14N2O2S — CID 95804126
(2R)-2-amino-N-methyl-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 95804126) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is (2R)-2-amino-N-methyl-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | (2R)-2-amino-N-methyl-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 95804126 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (2R)-2-amino-N-methyl-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)C[C@H](N)C2 |
| InChI | InChI=1S/C10H14N2O2S/c1-12-15(13,14)10-3-2-7-4-9(11)5-8(7)6-10/h2-3,6,9,12H,4-5,11H2,1H3/t9-/m1/s1 |
| InChIKey | KOJUJRUGVOYRSN-SECBINFHSA-N |
| XLogP | 0.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |