C12H19N3 — CID 95804693
N,N-dimethyl-4-[(3S)-piperidin-3-yl]pyridin-2-amine (PubChem CID 95804693) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N,N-dimethyl-4-[(3S)-piperidin-3-yl]pyridin-2-amine.
| Compound Name | N,N-dimethyl-4-[(3S)-piperidin-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 95804693 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N,N-dimethyl-4-[(3S)-piperidin-3-yl]pyridin-2-amine |
| SMILES | CN(C)c1cc([C@@H]2CCCNC2)ccn1 |
| InChI | InChI=1S/C12H19N3/c1-15(2)12-8-10(5-7-14-12)11-4-3-6-13-9-11/h5,7-8,11,13H,3-4,6,9H2,1-2H3/t11-/m1/s1 |
| InChIKey | SJBZEOCNDLWMEO-LLVKDONJSA-N |
| XLogP | 1.61 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |