C21H20ClN5O — CID 95806520
[(3S)-3-[2-amino-5-(4-chlorophenyl)pyrimidin-4-yl]piperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 95806520) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is [(3S)-3-[2-amino-5-(4-chlorophenyl)pyrimidin-4-yl]piperidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3S)-3-[2-amino-5-(4-chlorophenyl)pyrimidin-4-yl]piperidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 95806520 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(3S)-3-[2-amino-5-(4-chlorophenyl)pyrimidin-4-yl]piperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | Nc1ncc(-c2ccc(Cl)cc2)c([C@H]2CCCN(C(=O)c3cccnc3)C2)n1 |
| InChI | InChI=1S/C21H20ClN5O/c22-17-7-5-14(6-8-17)18-12-25-21(23)26-19(18)16-4-2-10-27(13-16)20(28)15-3-1-9-24-11-15/h1,3,5-9,11-12,16H,2,4,10,13H2,(H2,23,25,26)/t16-/m0/s1 |
| InChIKey | WZMLSWMBGWFMFZ-INIZCTEOSA-N |
| XLogP | 3.79 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |