C20H19N5O3 — CID 95807011
N-[1-(1,3-benzodioxol-5-yl)cyclopentyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 95807011) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)cyclopentyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)cyclopentyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 95807011 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)cyclopentyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NC1(c2ccc3c(c2)OCO3)CCCC1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C20H19N5O3/c26-19(14-4-3-5-16(10-14)25-12-21-23-24-25)22-20(8-1-2-9-20)15-6-7-17-18(11-15)28-13-27-17/h3-7,10-12H,1-2,8-9,13H2,(H,22,26) |
| InChIKey | HNEJHRWDKGNBLI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |