C19H25N5O — CID 95808188
(2S,6R)-4-(4-ethyl-11,13-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-yl)-2,6-dimethylmorpholine (PubChem CID 95808188) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is (2S,6R)-4-(4-ethyl-11,13-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-yl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(4-ethyl-11,13-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 95808188 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (2S,6R)-4-(4-ethyl-11,13-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-yl)-2,6-dimethylmorpholine |
| SMILES | CCc1cc(N2C[C@@H](C)O[C@@H](C)C2)n2nc3nc(C)cc(C)c3c2n1 |
| InChI | InChI=1S/C19H25N5O/c1-6-15-8-16(23-9-13(4)25-14(5)10-23)24-19(21-15)17-11(2)7-12(3)20-18(17)22-24/h7-8,13-14H,6,9-10H2,1-5H3/t13-,14+ |
| InChIKey | UBPQHVXRTCLRNO-OKILXGFUSA-N |
| XLogP | 3.07 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |