C13H21N3 — CID 95808772
(2R)-1-cyclopentyl-2-(1H-pyrazol-5-yl)piperidine (PubChem CID 95808772) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (2R)-1-cyclopentyl-2-(1H-pyrazol-5-yl)piperidine.
| Compound Name | (2R)-1-cyclopentyl-2-(1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 95808772 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (2R)-1-cyclopentyl-2-(1H-pyrazol-5-yl)piperidine |
| SMILES | c1cc([C@H]2CCCCN2C2CCCC2)[nH]n1 |
| InChI | InChI=1S/C13H21N3/c1-2-6-11(5-1)16-10-4-3-7-13(16)12-8-9-14-15-12/h8-9,11,13H,1-7,10H2,(H,14,15)/t13-/m1/s1 |
| InChIKey | YJPMDQFUBTUBTI-CYBMUJFWSA-N |
| XLogP | 2.88 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |