About (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride
(1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride (PubChem CID 9581) has the molecular formula C10H16ClNO
and a molecular weight of 201.70 g/mol. Its IUPAC name is (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride |
| PubChem CID | 9581 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride |
| SMILES | CN[C@@H](C)[C@@H](O)c1ccccc1.Cl |
| InChI | InChI=1S/C10H15NO.ClH/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H/t8-,10+;/m0./s1 |
| InChIKey | BALXUFOVQVENIU-KXNXZCPBSA-N |
| XLogP | 1.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride?
The IUPAC name of (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride (CID 9581) is (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride.
What is the SMILES notation for (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride?
The canonical SMILES for (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride is CN[C@@H](C)[C@@H](O)c1ccccc1.Cl.
What is the InChIKey of (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride?
The InChIKey is BALXUFOVQVENIU-KXNXZCPBSA-N. The full InChI is InChI=1S/C10H15NO.ClH/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H/t8-,10+;/m0./s1.
What are the key properties of (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride?
(1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride has a molecular weight of 201.70 g/mol, XLogP of 1.75, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol;hydrochloride is sourced from PubChem (CID 9581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).