C20H21ClN4O2S — CID 95810780
2-[(2-chlorophenyl)methyl]-6-[(3R)-1-(1H-pyrazol-4-ylsulfonyl)piperidin-3-yl]pyridine (PubChem CID 95810780) has the molecular formula C20H21ClN4O2S and a molecular weight of 416.93 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-6-[(3R)-1-(1H-pyrazol-4-ylsulfonyl)piperidin-3-yl]pyridine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-6-[(3R)-1-(1H-pyrazol-4-ylsulfonyl)piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 95810780 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-6-[(3R)-1-(1H-pyrazol-4-ylsulfonyl)piperidin-3-yl]pyridine |
| SMILES | O=S(=O)(c1cn[nH]c1)N1CCC[C@@H](c2cccc(Cc3ccccc3Cl)n2)C1 |
| InChI | InChI=1S/C20H21ClN4O2S/c21-19-8-2-1-5-15(19)11-17-7-3-9-20(24-17)16-6-4-10-25(14-16)28(26,27)18-12-22-23-13-18/h1-3,5,7-9,12-13,16H,4,6,10-11,14H2,(H,22,23)/t16-/m1/s1 |
| InChIKey | IBLPWHXWIMBZMB-MRXNPFEDSA-N |
| XLogP | 3.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |