C25H23FN4O3 — CID 95811716
3-[(2R)-2-[[3-(3-fluorophenyl)phenyl]methyl]-3-oxo-4-prop-2-enylpiperazine-1-carbonyl]-1H-pyridazin-6-one (PubChem CID 95811716) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is 3-[(2R)-2-[[3-(3-fluorophenyl)phenyl]methyl]-3-oxo-4-prop-2-enylpiperazine-1-carbonyl]-1H-pyridazin-6-one.
| Compound Name | 3-[(2R)-2-[[3-(3-fluorophenyl)phenyl]methyl]-3-oxo-4-prop-2-enylpiperazine-1-carbonyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 95811716 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 3-[(2R)-2-[[3-(3-fluorophenyl)phenyl]methyl]-3-oxo-4-prop-2-enylpiperazine-1-carbonyl]-1H-pyridazin-6-one |
| SMILES | C=CCN1CCN(C(=O)c2ccc(=O)[nH]n2)[C@H](Cc2cccc(-c3cccc(F)c3)c2)C1=O |
| InChI | InChI=1S/C25H23FN4O3/c1-2-11-29-12-13-30(24(32)21-9-10-23(31)28-27-21)22(25(29)33)15-17-5-3-6-18(14-17)19-7-4-8-20(26)16-19/h2-10,14,16,22H,1,11-13,15H2,(H,28,31)/t22-/m1/s1 |
| InChIKey | XLYVBBQMWIDMBM-JOCHJYFZSA-N |
| XLogP | 2.66 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|