About (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one
(3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one (PubChem CID 95812166) has the molecular formula C25H27N3O3
and a molecular weight of 417.51 g/mol. Its IUPAC name is (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one.
Molecular Properties
| Compound Name | (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one |
| PubChem CID | 95812166 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one |
| SMILES | COc1ccc(OC)c(CN2CCNC(=O)[C@@H]2Cc2ccc(-c3cccnc3)cc2)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-30-22-9-10-24(31-2)21(15-22)17-28-13-12-27-25(29)23(28)14-18-5-7-19(8-6-18)20-4-3-11-26-16-20/h3-11,15-16,23H,12-14,17H2,1-2H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | PYWBEKDRNYERND-QHCPKHFHSA-N |
| XLogP | 3.31 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one?
The IUPAC name of (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one (CID 95812166) is (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one.
What is the SMILES notation for (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one?
The canonical SMILES for (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one is COc1ccc(OC)c(CN2CCNC(=O)[C@@H]2Cc2ccc(-c3cccnc3)cc2)c1.
What is the InChIKey of (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one?
The InChIKey is PYWBEKDRNYERND-QHCPKHFHSA-N. The full InChI is InChI=1S/C25H27N3O3/c1-30-22-9-10-24(31-2)21(15-22)17-28-13-12-27-25(29)23(28)14-18-5-7-19(8-6-18)20-4-3-11-26-16-20/h3-11,15-16,23H,12-14,17H2,1-2H3,(H,27,29)/t23-/m0/s1.
What are the key properties of (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one?
(3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one has a molecular weight of 417.51 g/mol, XLogP of 3.31, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-[(2,5-dimethoxyphenyl)methyl]-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one is sourced from PubChem (CID 95812166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).