C20H19FN6O — CID 95813246
N-(3-fluorophenyl)-5-[(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-amine (PubChem CID 95813246) has the molecular formula C20H19FN6O and a molecular weight of 378.41 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5-[(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-amine.
| Compound Name | N-(3-fluorophenyl)-5-[(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-amine |
|---|---|
| PubChem CID | 95813246 |
| Molecular Formula | C20H19FN6O |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(3-fluorophenyl)-5-[(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-amine |
| SMILES | Cc1nnc2ccc(CN3CCc4onc(Nc5cccc(F)c5)c4C3)cn12 |
| InChI | InChI=1S/C20H19FN6O/c1-13-23-24-19-6-5-14(11-27(13)19)10-26-8-7-18-17(12-26)20(25-28-18)22-16-4-2-3-15(21)9-16/h2-6,9,11H,7-8,10,12H2,1H3,(H,22,25) |
| InChIKey | SNMJJUXXHRJKJB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |