C22H22N4O2 — CID 95813317
2-phenoxy-1-[(2S)-2-[5-(pyridin-2-ylamino)-2-pyridinyl]pyrrolidin-1-yl]ethanone (PubChem CID 95813317) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-phenoxy-1-[(2S)-2-[5-(pyridin-2-ylamino)-2-pyridinyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-phenoxy-1-[(2S)-2-[5-(pyridin-2-ylamino)-2-pyridinyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95813317 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-phenoxy-1-[(2S)-2-[5-(pyridin-2-ylamino)-2-pyridinyl]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(COc1ccccc1)N1CCC[C@H]1c1ccc(Nc2ccccn2)cn1 |
| InChI | InChI=1S/C22H22N4O2/c27-22(16-28-18-7-2-1-3-8-18)26-14-6-9-20(26)19-12-11-17(15-24-19)25-21-10-4-5-13-23-21/h1-5,7-8,10-13,15,20H,6,9,14,16H2,(H,23,25)/t20-/m0/s1 |
| InChIKey | HNJRTKGRBFSUIG-FQEVSTJZSA-N |
| XLogP | 3.96 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |