C24H30N4O2S — CID 95814484
4-benzyl-2-[(3R)-1-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperidin-3-yl]-6-methylpyridine (PubChem CID 95814484) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 4-benzyl-2-[(3R)-1-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperidin-3-yl]-6-methylpyridine.
| Compound Name | 4-benzyl-2-[(3R)-1-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperidin-3-yl]-6-methylpyridine |
|---|---|
| PubChem CID | 95814484 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 4-benzyl-2-[(3R)-1-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperidin-3-yl]-6-methylpyridine |
| SMILES | CCn1cc(S(=O)(=O)N2CCC[C@@H](c3cc(Cc4ccccc4)cc(C)n3)C2)c(C)n1 |
| InChI | InChI=1S/C24H30N4O2S/c1-4-27-17-24(19(3)26-27)31(29,30)28-12-8-11-22(16-28)23-15-21(13-18(2)25-23)14-20-9-6-5-7-10-20/h5-7,9-10,13,15,17,22H,4,8,11-12,14,16H2,1-3H3/t22-/m1/s1 |
| InChIKey | DKLVQSDXCWJYLV-JOCHJYFZSA-N |
| XLogP | 4.07 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |