C25H33N3O2 — CID 95817931
N-cyclohexyl-2-[(2S)-2-[6-[(2-methoxyphenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]acetamide (PubChem CID 95817931) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2S)-2-[6-[(2-methoxyphenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[(2S)-2-[6-[(2-methoxyphenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95817931 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-cyclohexyl-2-[(2S)-2-[6-[(2-methoxyphenyl)methyl]-2-pyridinyl]pyrrolidin-1-yl]acetamide |
| SMILES | COc1ccccc1Cc1cccc([C@@H]2CCCN2CC(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C25H33N3O2/c1-30-24-15-6-5-9-19(24)17-21-12-7-13-22(26-21)23-14-8-16-28(23)18-25(29)27-20-10-3-2-4-11-20/h5-7,9,12-13,15,20,23H,2-4,8,10-11,14,16-18H2,1H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | OEMJZXXOBVKUFA-QHCPKHFHSA-N |
| XLogP | 4.27 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |