C24H27N3O3 — CID 95821039
4-[5-[(3S)-1-(2-phenylmethoxyethyl)piperidin-3-yl]-1H-pyrazol-4-yl]benzoic acid (PubChem CID 95821039) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-[5-[(3S)-1-(2-phenylmethoxyethyl)piperidin-3-yl]-1H-pyrazol-4-yl]benzoic acid.
| Compound Name | 4-[5-[(3S)-1-(2-phenylmethoxyethyl)piperidin-3-yl]-1H-pyrazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 95821039 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-[5-[(3S)-1-(2-phenylmethoxyethyl)piperidin-3-yl]-1H-pyrazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cn[nH]c2[C@H]2CCCN(CCOCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c28-24(29)20-10-8-19(9-11-20)22-15-25-26-23(22)21-7-4-12-27(16-21)13-14-30-17-18-5-2-1-3-6-18/h1-3,5-6,8-11,15,21H,4,7,12-14,16-17H2,(H,25,26)(H,28,29)/t21-/m0/s1 |
| InChIKey | AJLQQRRXEITPPZ-NRFANRHFSA-N |
| XLogP | 4.17 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|