C18H21N3O3 — CID 95821938
1-[(3R)-3-[6-(3-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]ethanone (PubChem CID 95821938) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[(3R)-3-[6-(3-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-[6-(3-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95821938 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[(3R)-3-[6-(3-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]ethanone |
| SMILES | COc1cccc(Oc2cncc([C@@H]3CCCN(C(C)=O)C3)n2)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-13(22)21-8-4-5-14(12-21)17-10-19-11-18(20-17)24-16-7-3-6-15(9-16)23-2/h3,6-7,9-11,14H,4-5,8,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | NZBHBWOBKRIQDR-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |