C17H21N5O — CID 95821987
1-[4-[3-[(6-methyl-2-pyridinyl)amino]pyrazin-2-yl]piperidin-1-yl]ethanone (PubChem CID 95821987) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-[4-[3-[(6-methyl-2-pyridinyl)amino]pyrazin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[3-[(6-methyl-2-pyridinyl)amino]pyrazin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95821987 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-[4-[3-[(6-methyl-2-pyridinyl)amino]pyrazin-2-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2nccnc2Nc2cccc(C)n2)CC1 |
| InChI | InChI=1S/C17H21N5O/c1-12-4-3-5-15(20-12)21-17-16(18-8-9-19-17)14-6-10-22(11-7-14)13(2)23/h3-5,8-9,14H,6-7,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | QPFUIVSXAASUQU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |