About 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine
3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine (PubChem CID 95822110) has the molecular formula C18H26N6
and a molecular weight of 326.45 g/mol. Its IUPAC name is 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine |
| PubChem CID | 95822110 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine |
| SMILES | CC(C)(C)CN1CCC(c2nccnc2Nc2cnccn2)CC1 |
| InChI | InChI=1S/C18H26N6/c1-18(2,3)13-24-10-4-14(5-11-24)16-17(22-9-8-21-16)23-15-12-19-6-7-20-15/h6-9,12,14H,4-5,10-11,13H2,1-3H3,(H,20,22,23) |
| InChIKey | SQBDIRXACPWKRL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine?
The IUPAC name of 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine (CID 95822110) is 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine.
What is the SMILES notation for 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine?
The canonical SMILES for 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine is CC(C)(C)CN1CCC(c2nccnc2Nc2cnccn2)CC1.
What is the InChIKey of 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine?
The InChIKey is SQBDIRXACPWKRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N6/c1-18(2,3)13-24-10-4-14(5-11-24)16-17(22-9-8-21-16)23-15-12-19-6-7-20-15/h6-9,12,14H,4-5,10-11,13H2,1-3H3,(H,20,22,23).
What are the key properties of 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine?
3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine has a molecular weight of 326.45 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-N-pyrazin-2-ylpyrazin-2-amine is sourced from PubChem (CID 95822110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).