C21H22N6O2 — CID 95823181
(2-amino-6-methylpyrimidin-4-yl)-[(3R)-3-(6-phenoxypyrazin-2-yl)piperidin-1-yl]methanone (PubChem CID 95823181) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is (2-amino-6-methylpyrimidin-4-yl)-[(3R)-3-(6-phenoxypyrazin-2-yl)piperidin-1-yl]methanone.
| Compound Name | (2-amino-6-methylpyrimidin-4-yl)-[(3R)-3-(6-phenoxypyrazin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95823181 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (2-amino-6-methylpyrimidin-4-yl)-[(3R)-3-(6-phenoxypyrazin-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC[C@@H](c3cncc(Oc4ccccc4)n3)C2)nc(N)n1 |
| InChI | InChI=1S/C21H22N6O2/c1-14-10-17(26-21(22)24-14)20(28)27-9-5-6-15(13-27)18-11-23-12-19(25-18)29-16-7-3-2-4-8-16/h2-4,7-8,10-12,15H,5-6,9,13H2,1H3,(H2,22,24,26)/t15-/m1/s1 |
| InChIKey | PYWMHCBQTBIESW-OAHLLOKOSA-N |
| XLogP | 2.97 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |