C17H20FN3 — CID 95825266
N-[(3-fluorophenyl)methyl]-2-piperidin-4-ylpyridin-4-amine (PubChem CID 95825266) has the molecular formula C17H20FN3 and a molecular weight of 285.37 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-piperidin-4-ylpyridin-4-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-piperidin-4-ylpyridin-4-amine |
|---|---|
| PubChem CID | 95825266 |
| Molecular Formula | C17H20FN3 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-piperidin-4-ylpyridin-4-amine |
| SMILES | Fc1cccc(CNc2ccnc(C3CCNCC3)c2)c1 |
| InChI | InChI=1S/C17H20FN3/c18-15-3-1-2-13(10-15)12-21-16-6-9-20-17(11-16)14-4-7-19-8-5-14/h1-3,6,9-11,14,19H,4-5,7-8,12H2,(H,20,21) |
| InChIKey | FATYFTSGHCWOCP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |