C17H21N3O — CID 95825460
2-[(2-methoxyphenyl)methyl]-5-[(3R)-piperidin-3-yl]pyrazine (PubChem CID 95825460) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methyl]-5-[(3R)-piperidin-3-yl]pyrazine.
| Compound Name | 2-[(2-methoxyphenyl)methyl]-5-[(3R)-piperidin-3-yl]pyrazine |
|---|---|
| PubChem CID | 95825460 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-[(2-methoxyphenyl)methyl]-5-[(3R)-piperidin-3-yl]pyrazine |
| SMILES | COc1ccccc1Cc1cnc([C@@H]2CCCNC2)cn1 |
| InChI | InChI=1S/C17H21N3O/c1-21-17-7-3-2-5-13(17)9-15-11-20-16(12-19-15)14-6-4-8-18-10-14/h2-3,5,7,11-12,14,18H,4,6,8-10H2,1H3/t14-/m1/s1 |
| InChIKey | IJZXINBYVYDHJX-CQSZACIVSA-N |
| XLogP | 2.54 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |