C16H25N5O — CID 95825474
2-[[2-methyl-6-[(2S)-pyrrolidin-2-yl]pyrimidin-4-yl]amino]-1-piperidin-1-ylethanone (PubChem CID 95825474) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[[2-methyl-6-[(2S)-pyrrolidin-2-yl]pyrimidin-4-yl]amino]-1-piperidin-1-ylethanone.
| Compound Name | 2-[[2-methyl-6-[(2S)-pyrrolidin-2-yl]pyrimidin-4-yl]amino]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 95825474 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 2-[[2-methyl-6-[(2S)-pyrrolidin-2-yl]pyrimidin-4-yl]amino]-1-piperidin-1-ylethanone |
| SMILES | Cc1nc(NCC(=O)N2CCCCC2)cc([C@@H]2CCCN2)n1 |
| InChI | InChI=1S/C16H25N5O/c1-12-19-14(13-6-5-7-17-13)10-15(20-12)18-11-16(22)21-8-3-2-4-9-21/h10,13,17H,2-9,11H2,1H3,(H,18,19,20)/t13-/m0/s1 |
| InChIKey | ODYISMKNJLIFQH-ZDUSSCGKSA-N |
| XLogP | 1.63 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |