C17H25N5 — CID 95825517
N-[2-(3-methylpyrazol-1-yl)ethyl]-6-[[(3S)-piperidin-3-yl]methyl]pyridin-2-amine (PubChem CID 95825517) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-[2-(3-methylpyrazol-1-yl)ethyl]-6-[[(3S)-piperidin-3-yl]methyl]pyridin-2-amine.
| Compound Name | N-[2-(3-methylpyrazol-1-yl)ethyl]-6-[[(3S)-piperidin-3-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 95825517 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | N-[2-(3-methylpyrazol-1-yl)ethyl]-6-[[(3S)-piperidin-3-yl]methyl]pyridin-2-amine |
| SMILES | Cc1ccn(CCNc2cccc(C[C@@H]3CCCNC3)n2)n1 |
| InChI | InChI=1S/C17H25N5/c1-14-7-10-22(21-14)11-9-19-17-6-2-5-16(20-17)12-15-4-3-8-18-13-15/h2,5-7,10,15,18H,3-4,8-9,11-13H2,1H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | UITBELZIUDYSFZ-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |