About N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide
N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide (PubChem CID 95825863) has the molecular formula C14H17N5OS
and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide |
| PubChem CID | 95825863 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2nccnc2C2CCNCC2)s1 |
| InChI | InChI=1S/C14H17N5OS/c1-9-8-18-14(21-9)19-13(20)12-11(16-6-7-17-12)10-2-4-15-5-3-10/h6-8,10,15H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | ICUSVSSAERNBQX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide?
The IUPAC name of N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide (CID 95825863) is N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide.
What is the SMILES notation for N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide?
The canonical SMILES for N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide is Cc1cnc(NC(=O)c2nccnc2C2CCNCC2)s1.
What is the InChIKey of N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide?
The InChIKey is ICUSVSSAERNBQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5OS/c1-9-8-18-14(21-9)19-13(20)12-11(16-6-7-17-12)10-2-4-15-5-3-10/h6-8,10,15H,2-5H2,1H3,(H,18,19,20).
What are the key properties of N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide?
N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide has a molecular weight of 303.39 g/mol, XLogP of 1.96, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-4-ylpyrazine-2-carboxamide is sourced from PubChem (CID 95825863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).