C16H17FN4O — CID 95826652
(3R)-N-[(4-fluorophenyl)methyl]-1-pyrimidin-2-ylpyrrolidine-3-carboxamide (PubChem CID 95826652) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is (3R)-N-[(4-fluorophenyl)methyl]-1-pyrimidin-2-ylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(4-fluorophenyl)methyl]-1-pyrimidin-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95826652 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3R)-N-[(4-fluorophenyl)methyl]-1-pyrimidin-2-ylpyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)[C@@H]1CCN(c2ncccn2)C1 |
| InChI | InChI=1S/C16H17FN4O/c17-14-4-2-12(3-5-14)10-20-15(22)13-6-9-21(11-13)16-18-7-1-8-19-16/h1-5,7-8,13H,6,9-11H2,(H,20,22)/t13-/m1/s1 |
| InChIKey | BXYSLGQHAKGMBJ-CYBMUJFWSA-N |
| XLogP | 1.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |