About pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone
pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 95828499) has the molecular formula C12H13N5OS
and a molecular weight of 275.34 g/mol. Its IUPAC name is pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone |
| PubChem CID | 95828499 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cncnc1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C12H13N5OS/c18-11(10-7-13-9-14-8-10)16-2-4-17(5-3-16)12-15-1-6-19-12/h1,6-9H,2-5H2 |
| InChIKey | CBNOFSASHXSJIO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone?
The IUPAC name of pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone (CID 95828499) is pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone.
What is the SMILES notation for pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone?
The canonical SMILES for pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone is O=C(c1cncnc1)N1CCN(c2nccs2)CC1.
What is the InChIKey of pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone?
The InChIKey is CBNOFSASHXSJIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5OS/c18-11(10-7-13-9-14-8-10)16-2-4-17(5-3-16)12-15-1-6-19-12/h1,6-9H,2-5H2.
What are the key properties of pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone?
pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone has a molecular weight of 275.34 g/mol, XLogP of 0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-5-yl-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone is sourced from PubChem (CID 95828499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).