About 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide
1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide (PubChem CID 95829334) has the molecular formula C16H22N6O
and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide |
| PubChem CID | 95829334 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide |
| SMILES | Cc1cc(C)nc(N2CCC(Cn3cc(C(N)=O)cn3)CC2)n1 |
| InChI | InChI=1S/C16H22N6O/c1-11-7-12(2)20-16(19-11)21-5-3-13(4-6-21)9-22-10-14(8-18-22)15(17)23/h7-8,10,13H,3-6,9H2,1-2H3,(H2,17,23) |
| InChIKey | OSAAQFIYGJFORC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide?
The IUPAC name of 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide (CID 95829334) is 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide.
What is the SMILES notation for 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide?
The canonical SMILES for 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide is Cc1cc(C)nc(N2CCC(Cn3cc(C(N)=O)cn3)CC2)n1.
What is the InChIKey of 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide?
The InChIKey is OSAAQFIYGJFORC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N6O/c1-11-7-12(2)20-16(19-11)21-5-3-13(4-6-21)9-22-10-14(8-18-22)15(17)23/h7-8,10,13H,3-6,9H2,1-2H3,(H2,17,23).
What are the key properties of 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide?
1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide has a molecular weight of 314.39 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazole-4-carboxamide is sourced from PubChem (CID 95829334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).