C25H28N2O3S — CID 95830568
3-[[(2R)-1-[4-(ethoxymethyl)benzoyl]piperidin-2-yl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 95830568) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-[[(2R)-1-[4-(ethoxymethyl)benzoyl]piperidin-2-yl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[[(2R)-1-[4-(ethoxymethyl)benzoyl]piperidin-2-yl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 95830568 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 3-[[(2R)-1-[4-(ethoxymethyl)benzoyl]piperidin-2-yl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCOCc1ccc(C(=O)N2CCCC[C@@H]2Cc2c(C(N)=O)sc3ccccc23)cc1 |
| InChI | InChI=1S/C25H28N2O3S/c1-2-30-16-17-10-12-18(13-11-17)25(29)27-14-6-5-7-19(27)15-21-20-8-3-4-9-22(20)31-23(21)24(26)28/h3-4,8-13,19H,2,5-7,14-16H2,1H3,(H2,26,28)/t19-/m1/s1 |
| InChIKey | APQNHCMZURKUSF-LJQANCHMSA-N |
| XLogP | 4.77 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |