C25H25ClN4O — CID 95831833
5-[[(3R)-3-[5-[2-(2-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]pyrrolidin-1-yl]methyl]quinoline (PubChem CID 95831833) has the molecular formula C25H25ClN4O and a molecular weight of 432.96 g/mol. Its IUPAC name is 5-[[(3R)-3-[5-[2-(2-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]pyrrolidin-1-yl]methyl]quinoline.
| Compound Name | 5-[[(3R)-3-[5-[2-(2-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]pyrrolidin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 95831833 |
| Molecular Formula | C25H25ClN4O |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 5-[[(3R)-3-[5-[2-(2-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]pyrrolidin-1-yl]methyl]quinoline |
| SMILES | Clc1ccccc1OCCc1cc([C@@H]2CCN(Cc3cccc4ncccc34)C2)n[nH]1 |
| InChI | InChI=1S/C25H25ClN4O/c26-22-7-1-2-9-25(22)31-14-11-20-15-24(29-28-20)19-10-13-30(17-19)16-18-5-3-8-23-21(18)6-4-12-27-23/h1-9,12,15,19H,10-11,13-14,16-17H2,(H,28,29)/t19-/m1/s1 |
| InChIKey | XXIKNKKBVRRXQW-LJQANCHMSA-N |
| XLogP | 5.22 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |