C23H28N6OS — CID 95832706
1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl-[(2S)-2-[6-methyl-4-[(4-methyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]pyrrolidin-1-yl]methanone (PubChem CID 95832706) has the molecular formula C23H28N6OS and a molecular weight of 436.59 g/mol. Its IUPAC name is 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl-[(2S)-2-[6-methyl-4-[(4-methyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]pyrrolidin-1-yl]methanone.
| Compound Name | 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl-[(2S)-2-[6-methyl-4-[(4-methyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95832706 |
| Molecular Formula | C23H28N6OS |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl-[(2S)-2-[6-methyl-4-[(4-methyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]pyrrolidin-1-yl]methanone |
| SMILES | Cc1cc(Nc2nc(C)cs2)cc([C@@H]2CCCN2C(=O)c2n[nH]c3c2CCCCC3)n1 |
| InChI | InChI=1S/C23H28N6OS/c1-14-11-16(26-23-25-15(2)13-31-23)12-19(24-14)20-9-6-10-29(20)22(30)21-17-7-4-3-5-8-18(17)27-28-21/h11-13,20H,3-10H2,1-2H3,(H,27,28)(H,24,25,26)/t20-/m0/s1 |
| InChIKey | DVPOXDHGNUHAIJ-FQEVSTJZSA-N |
| XLogP | 4.87 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |