C17H18N4O2 — CID 95833368
6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-diethylimidazo[1,2-b][1,2,4]triazine (PubChem CID 95833368) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-diethylimidazo[1,2-b][1,2,4]triazine.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-diethylimidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 95833368 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-diethylimidazo[1,2-b][1,2,4]triazine |
| SMILES | CCc1nc2nc(-c3ccc4c(c3)OCCO4)cn2nc1CC |
| InChI | InChI=1S/C17H18N4O2/c1-3-12-13(4-2)20-21-10-14(19-17(21)18-12)11-5-6-15-16(9-11)23-8-7-22-15/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | QKQJFVZGIQCYML-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |