About 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine
6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine (PubChem CID 95834167) has the molecular formula C21H23FN6
and a molecular weight of 378.46 g/mol. Its IUPAC name is 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine |
| PubChem CID | 95834167 |
| Molecular Formula | C21H23FN6 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine |
| SMILES | Cc1cc(N2CCC(c3ccc(Nc4ccc(F)cn4)cn3)CC2)nc(C)n1 |
| InChI | InChI=1S/C21H23FN6/c1-14-11-21(26-15(2)25-14)28-9-7-16(8-10-28)19-5-4-18(13-23-19)27-20-6-3-17(22)12-24-20/h3-6,11-13,16H,7-10H2,1-2H3,(H,24,27) |
| InChIKey | GIERHTUAEUJUKQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine?
The IUPAC name of 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine (CID 95834167) is 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine.
What is the SMILES notation for 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine?
The canonical SMILES for 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine is Cc1cc(N2CCC(c3ccc(Nc4ccc(F)cn4)cn3)CC2)nc(C)n1.
What is the InChIKey of 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine?
The InChIKey is GIERHTUAEUJUKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN6/c1-14-11-21(26-15(2)25-14)28-9-7-16(8-10-28)19-5-4-18(13-23-19)27-20-6-3-17(22)12-24-20/h3-6,11-13,16H,7-10H2,1-2H3,(H,24,27).
What are the key properties of 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine?
6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine has a molecular weight of 378.46 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-N-(5-fluoro-2-pyridinyl)pyridin-3-amine is sourced from PubChem (CID 95834167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).