C23H30N6O3 — CID 95834932
1-[2-[2-[(3R)-3-[6-methyl-4-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one (PubChem CID 95834932) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[2-[2-[(3R)-3-[6-methyl-4-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-[(3R)-3-[6-methyl-4-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95834932 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-[2-[2-[(3R)-3-[6-methyl-4-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one |
| SMILES | Cc1cc(Nc2cnccn2)cc([C@@H]2CCCN(C(=O)COCCN3CCCC3=O)C2)n1 |
| InChI | InChI=1S/C23H30N6O3/c1-17-12-19(27-21-14-24-6-7-25-21)13-20(26-17)18-4-2-9-29(15-18)23(31)16-32-11-10-28-8-3-5-22(28)30/h6-7,12-14,18H,2-5,8-11,15-16H2,1H3,(H,25,26,27)/t18-/m1/s1 |
| InChIKey | XXAWGHCYFUVJJT-GOSISDBHSA-N |
| XLogP | 2.27 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|