C22H21FN4O — CID 95836745
[(2R)-2-(2-amino-5-phenylpyrimidin-4-yl)piperidin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 95836745) has the molecular formula C22H21FN4O and a molecular weight of 376.44 g/mol. Its IUPAC name is [(2R)-2-(2-amino-5-phenylpyrimidin-4-yl)piperidin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(2R)-2-(2-amino-5-phenylpyrimidin-4-yl)piperidin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 95836745 |
| Molecular Formula | C22H21FN4O |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(2R)-2-(2-amino-5-phenylpyrimidin-4-yl)piperidin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | Nc1ncc(-c2ccccc2)c([C@H]2CCCCN2C(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H21FN4O/c23-17-11-9-16(10-12-17)21(28)27-13-5-4-8-19(27)20-18(14-25-22(24)26-20)15-6-2-1-3-7-15/h1-3,6-7,9-12,14,19H,4-5,8,13H2,(H2,24,25,26)/t19-/m1/s1 |
| InChIKey | WQXKMLWWRXBFQP-LJQANCHMSA-N |
| XLogP | 4.23 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |