C16H21FN2O3 — CID 95838198
(2S)-4-[2-(2-fluorophenyl)-2-methylpropanoyl]-2-methylmorpholine-2-carboxamide (PubChem CID 95838198) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is (2S)-4-[2-(2-fluorophenyl)-2-methylpropanoyl]-2-methylmorpholine-2-carboxamide.
| Compound Name | (2S)-4-[2-(2-fluorophenyl)-2-methylpropanoyl]-2-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 95838198 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2S)-4-[2-(2-fluorophenyl)-2-methylpropanoyl]-2-methylmorpholine-2-carboxamide |
| SMILES | CC(C)(C(=O)N1CCO[C@](C)(C(N)=O)C1)c1ccccc1F |
| InChI | InChI=1S/C16H21FN2O3/c1-15(2,11-6-4-5-7-12(11)17)14(21)19-8-9-22-16(3,10-19)13(18)20/h4-7H,8-10H2,1-3H3,(H2,18,20)/t16-/m0/s1 |
| InChIKey | DGRPTDCLZQBSRV-INIZCTEOSA-N |
| XLogP | 1.21 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |