C11H16N4O2 — CID 95839704
(3S)-N-methyl-1-(1-methylpyrazole-4-carbonyl)pyrrolidine-3-carboxamide (PubChem CID 95839704) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3S)-N-methyl-1-(1-methylpyrazole-4-carbonyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-methyl-1-(1-methylpyrazole-4-carbonyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95839704 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (3S)-N-methyl-1-(1-methylpyrazole-4-carbonyl)pyrrolidine-3-carboxamide |
| SMILES | CNC(=O)[C@H]1CCN(C(=O)c2cnn(C)c2)C1 |
| InChI | InChI=1S/C11H16N4O2/c1-12-10(16)8-3-4-15(7-8)11(17)9-5-13-14(2)6-9/h5-6,8H,3-4,7H2,1-2H3,(H,12,16)/t8-/m0/s1 |
| InChIKey | TWUVONAADYGXNV-QMMMGPOBSA-N |
| XLogP | -0.37 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |