C24H24N4O — CID 95840267
4-[[(2R)-2-[4-(3-methoxyphenyl)-1H-pyrazol-5-yl]pyrrolidin-1-yl]methyl]quinoline (PubChem CID 95840267) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[[(2R)-2-[4-(3-methoxyphenyl)-1H-pyrazol-5-yl]pyrrolidin-1-yl]methyl]quinoline.
| Compound Name | 4-[[(2R)-2-[4-(3-methoxyphenyl)-1H-pyrazol-5-yl]pyrrolidin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 95840267 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[[(2R)-2-[4-(3-methoxyphenyl)-1H-pyrazol-5-yl]pyrrolidin-1-yl]methyl]quinoline |
| SMILES | COc1cccc(-c2cn[nH]c2[C@H]2CCCN2Cc2ccnc3ccccc23)c1 |
| InChI | InChI=1S/C24H24N4O/c1-29-19-7-4-6-17(14-19)21-15-26-27-24(21)23-10-5-13-28(23)16-18-11-12-25-22-9-3-2-8-20(18)22/h2-4,6-9,11-12,14-15,23H,5,10,13,16H2,1H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | OZSFXZHPZNGIJS-HSZRJFAPSA-N |
| XLogP | 4.97 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |