C13H17N5O — CID 95840747
2-[3-[(3S)-1-pyrimidin-2-ylpyrrolidin-3-yl]-1H-pyrazol-5-yl]ethanol (PubChem CID 95840747) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[3-[(3S)-1-pyrimidin-2-ylpyrrolidin-3-yl]-1H-pyrazol-5-yl]ethanol.
| Compound Name | 2-[3-[(3S)-1-pyrimidin-2-ylpyrrolidin-3-yl]-1H-pyrazol-5-yl]ethanol |
|---|---|
| PubChem CID | 95840747 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-[3-[(3S)-1-pyrimidin-2-ylpyrrolidin-3-yl]-1H-pyrazol-5-yl]ethanol |
| SMILES | OCCc1cc([C@H]2CCN(c3ncccn3)C2)n[nH]1 |
| InChI | InChI=1S/C13H17N5O/c19-7-3-11-8-12(17-16-11)10-2-6-18(9-10)13-14-4-1-5-15-13/h1,4-5,8,10,19H,2-3,6-7,9H2,(H,16,17)/t10-/m0/s1 |
| InChIKey | PXTYNFCFZNUDDM-JTQLQIEISA-N |
| XLogP | 0.73 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |