About 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone
2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone (PubChem CID 95840957) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone.
Molecular Properties
| Compound Name | 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone |
| PubChem CID | 95840957 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone |
| SMILES | COCC(=O)N1CCOC[C@H](Cc2ccncn2)C1 |
| InChI | InChI=1S/C13H19N3O3/c1-18-9-13(17)16-4-5-19-8-11(7-16)6-12-2-3-14-10-15-12/h2-3,10-11H,4-9H2,1H3/t11-/m1/s1 |
| InChIKey | YMRCOUQMRSPVJU-LLVKDONJSA-N |
| XLogP | 0.14 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone?
The IUPAC name of 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone (CID 95840957) is 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone.
What is the SMILES notation for 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone?
The canonical SMILES for 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone is COCC(=O)N1CCOC[C@H](Cc2ccncn2)C1.
What is the InChIKey of 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone?
The InChIKey is YMRCOUQMRSPVJU-LLVKDONJSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-18-9-13(17)16-4-5-19-8-11(7-16)6-12-2-3-14-10-15-12/h2-3,10-11H,4-9H2,1H3/t11-/m1/s1.
What are the key properties of 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone?
2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone has a molecular weight of 265.31 g/mol, XLogP of 0.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-[(6R)-6-(pyrimidin-4-ylmethyl)-1,4-oxazepan-4-yl]ethanone is sourced from PubChem (CID 95840957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).