C12H18N4O — CID 95841666
N,N-dimethyl-2-[(2S)-2-pyrazin-2-ylpyrrolidin-1-yl]acetamide (PubChem CID 95841666) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2S)-2-pyrazin-2-ylpyrrolidin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[(2S)-2-pyrazin-2-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95841666 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | N,N-dimethyl-2-[(2S)-2-pyrazin-2-ylpyrrolidin-1-yl]acetamide |
| SMILES | CN(C)C(=O)CN1CCC[C@H]1c1cnccn1 |
| InChI | InChI=1S/C12H18N4O/c1-15(2)12(17)9-16-7-3-4-11(16)10-8-13-5-6-14-10/h5-6,8,11H,3-4,7,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | MRRLCQTXGIOQNC-NSHDSACASA-N |
| XLogP | 0.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |