C20H17ClN4O2 — CID 95843678
[(2R)-2-[6-(4-chlorophenoxy)pyrazin-2-yl]pyrrolidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 95843678) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is [(2R)-2-[6-(4-chlorophenoxy)pyrazin-2-yl]pyrrolidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [(2R)-2-[6-(4-chlorophenoxy)pyrazin-2-yl]pyrrolidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 95843678 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [(2R)-2-[6-(4-chlorophenoxy)pyrazin-2-yl]pyrrolidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCC[C@@H]1c1cncc(Oc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H17ClN4O2/c21-14-6-8-15(9-7-14)27-19-13-22-12-17(24-19)18-5-3-11-25(18)20(26)16-4-1-2-10-23-16/h1-2,4,6-10,12-13,18H,3,5,11H2/t18-/m1/s1 |
| InChIKey | UQGPKMNGMBHEFA-GOSISDBHSA-N |
| XLogP | 4.29 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |