C12H20N4O2S — CID 95845148
N,N-dimethyl-4-(6-methylpyrazin-2-yl)piperidine-1-sulfonamide (PubChem CID 95845148) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is N,N-dimethyl-4-(6-methylpyrazin-2-yl)piperidine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(6-methylpyrazin-2-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 95845148 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N,N-dimethyl-4-(6-methylpyrazin-2-yl)piperidine-1-sulfonamide |
| SMILES | Cc1cncc(C2CCN(S(=O)(=O)N(C)C)CC2)n1 |
| InChI | InChI=1S/C12H20N4O2S/c1-10-8-13-9-12(14-10)11-4-6-16(7-5-11)19(17,18)15(2)3/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | YWFZCJSRWFGUOS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |