About [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone
[(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone (PubChem CID 95846137) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone |
| PubChem CID | 95846137 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone |
| SMILES | Cc1cncc([C@@H]2CCCN(C(=O)c3cnco3)C2)n1 |
| InChI | InChI=1S/C14H16N4O2/c1-10-5-15-6-12(17-10)11-3-2-4-18(8-11)14(19)13-7-16-9-20-13/h5-7,9,11H,2-4,8H2,1H3/t11-/m1/s1 |
| InChIKey | RCAZBOPXCVWPTC-LLVKDONJSA-N |
| XLogP | 1.79 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone?
The IUPAC name of [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone (CID 95846137) is [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone.
What is the SMILES notation for [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone?
The canonical SMILES for [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone is Cc1cncc([C@@H]2CCCN(C(=O)c3cnco3)C2)n1.
What is the InChIKey of [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone?
The InChIKey is RCAZBOPXCVWPTC-LLVKDONJSA-N. The full InChI is InChI=1S/C14H16N4O2/c1-10-5-15-6-12(17-10)11-3-2-4-18(8-11)14(19)13-7-16-9-20-13/h5-7,9,11H,2-4,8H2,1H3/t11-/m1/s1.
What are the key properties of [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone?
[(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone has a molecular weight of 272.31 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]-(1,3-oxazol-5-yl)methanone is sourced from PubChem (CID 95846137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).