C18H27N5O2 — CID 95846960
1-[4-[6-[[(3S)-1-acetylpiperidin-3-yl]methyl]pyridazin-3-yl]piperazin-1-yl]ethanone (PubChem CID 95846960) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[4-[6-[[(3S)-1-acetylpiperidin-3-yl]methyl]pyridazin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[6-[[(3S)-1-acetylpiperidin-3-yl]methyl]pyridazin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 95846960 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-[4-[6-[[(3S)-1-acetylpiperidin-3-yl]methyl]pyridazin-3-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(C[C@@H]3CCCN(C(C)=O)C3)nn2)CC1 |
| InChI | InChI=1S/C18H27N5O2/c1-14(24)21-8-10-22(11-9-21)18-6-5-17(19-20-18)12-16-4-3-7-23(13-16)15(2)25/h5-6,16H,3-4,7-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | SRSJXYCRJAUBTR-INIZCTEOSA-N |
| XLogP | 0.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |