About 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine
2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine (PubChem CID 95849195) has the molecular formula C16H15BrN4O3
and a molecular weight of 391.23 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine.
Molecular Properties
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine |
| PubChem CID | 95849195 |
| Molecular Formula | C16H15BrN4O3 |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine |
| SMILES | COCCNc1c(-c2cc3c(cc2Br)OCO3)nc2cnccn12 |
| InChI | InChI=1S/C16H15BrN4O3/c1-22-5-3-19-16-15(20-14-8-18-2-4-21(14)16)10-6-12-13(7-11(10)17)24-9-23-12/h2,4,6-8,19H,3,5,9H2,1H3 |
| InChIKey | UEBYDJQFCSBZMO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine?
The IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine (CID 95849195) is 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine.
What is the SMILES notation for 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine?
The canonical SMILES for 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine is COCCNc1c(-c2cc3c(cc2Br)OCO3)nc2cnccn12.
What is the InChIKey of 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine?
The InChIKey is UEBYDJQFCSBZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrN4O3/c1-22-5-3-19-16-15(20-14-8-18-2-4-21(14)16)10-6-12-13(7-11(10)17)24-9-23-12/h2,4,6-8,19H,3,5,9H2,1H3.
What are the key properties of 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine?
2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine has a molecular weight of 391.23 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-3-amine is sourced from PubChem (CID 95849195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).